About (1-methylpyrazol-4-yl) N-ethylcarbamate
(1-methylpyrazol-4-yl) N-ethylcarbamate (PubChem CID 54394842) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl) N-ethylcarbamate.
Molecular Properties
| Compound Name | (1-methylpyrazol-4-yl) N-ethylcarbamate |
| PubChem CID | 54394842 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (1-methylpyrazol-4-yl) N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1cnn(C)c1 |
| InChI | InChI=1S/C7H11N3O2/c1-3-8-7(11)12-6-4-9-10(2)5-6/h4-5H,3H2,1-2H3,(H,8,11) |
| InChIKey | VJEXTCWXLZJIMR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpyrazol-4-yl) N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-4-yl) N-ethylcarbamate?
The IUPAC name of (1-methylpyrazol-4-yl) N-ethylcarbamate (CID 54394842) is (1-methylpyrazol-4-yl) N-ethylcarbamate.
What is the SMILES notation for (1-methylpyrazol-4-yl) N-ethylcarbamate?
The canonical SMILES for (1-methylpyrazol-4-yl) N-ethylcarbamate is CCNC(=O)Oc1cnn(C)c1.
What is the InChIKey of (1-methylpyrazol-4-yl) N-ethylcarbamate?
The InChIKey is VJEXTCWXLZJIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-3-8-7(11)12-6-4-9-10(2)5-6/h4-5H,3H2,1-2H3,(H,8,11).
What are the key properties of (1-methylpyrazol-4-yl) N-ethylcarbamate?
(1-methylpyrazol-4-yl) N-ethylcarbamate has a molecular weight of 169.18 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-4-yl) N-ethylcarbamate is sourced from PubChem (CID 54394842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).