About (3-iodophenyl) (2R)-2-hydroxypropanoate
(3-iodophenyl) (2R)-2-hydroxypropanoate (PubChem CID 130670103) has the molecular formula C9H9IO3
and a molecular weight of 292.07 g/mol. Its IUPAC name is (3-iodophenyl) (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | (3-iodophenyl) (2R)-2-hydroxypropanoate |
| PubChem CID | 130670103 |
| Molecular Formula | C9H9IO3 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | (3-iodophenyl) (2R)-2-hydroxypropanoate |
| SMILES | C[C@@H](O)C(=O)Oc1cccc(I)c1 |
| InChI | InChI=1S/C9H9IO3/c1-6(11)9(12)13-8-4-2-3-7(10)5-8/h2-6,11H,1H3/t6-/m1/s1 |
| InChIKey | YOFUJTTXNYKIKE-ZCFIWIBFSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl) (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl) (2R)-2-hydroxypropanoate?
The IUPAC name of (3-iodophenyl) (2R)-2-hydroxypropanoate (CID 130670103) is (3-iodophenyl) (2R)-2-hydroxypropanoate.
What is the SMILES notation for (3-iodophenyl) (2R)-2-hydroxypropanoate?
The canonical SMILES for (3-iodophenyl) (2R)-2-hydroxypropanoate is C[C@@H](O)C(=O)Oc1cccc(I)c1.
What is the InChIKey of (3-iodophenyl) (2R)-2-hydroxypropanoate?
The InChIKey is YOFUJTTXNYKIKE-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H9IO3/c1-6(11)9(12)13-8-4-2-3-7(10)5-8/h2-6,11H,1H3/t6-/m1/s1.
What are the key properties of (3-iodophenyl) (2R)-2-hydroxypropanoate?
(3-iodophenyl) (2R)-2-hydroxypropanoate has a molecular weight of 292.07 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl) (2R)-2-hydroxypropanoate is sourced from PubChem (CID 130670103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).