C17H24O9 — CID 143197438
[3,4-bis(2-hydroxypropanoyloxy)phenyl] 2-hydroxypropanoate;ethane (PubChem CID 143197438) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is [3,4-bis(2-hydroxypropanoyloxy)phenyl] 2-hydroxypropanoate;ethane.
| Compound Name | [3,4-bis(2-hydroxypropanoyloxy)phenyl] 2-hydroxypropanoate;ethane |
|---|---|
| PubChem CID | 143197438 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [3,4-bis(2-hydroxypropanoyloxy)phenyl] 2-hydroxypropanoate;ethane |
| SMILES | CC.CC(O)C(=O)Oc1ccc(OC(=O)C(C)O)c(OC(=O)C(C)O)c1 |
| InChI | InChI=1S/C15H18O9.C2H6/c1-7(16)13(19)22-10-4-5-11(23-14(20)8(2)17)12(6-10)24-15(21)9(3)18;1-2/h4-9,16-18H,1-3H3;1-2H3 |
| InChIKey | HGEXXXGGXPMCQJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|