C12H12ClNO2 — CID 13067056
(E)-4-(4-chlorophenyl)-N,N-dimethyl-4-oxobut-2-enamide (PubChem CID 13067056) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is (E)-4-(4-chlorophenyl)-N,N-dimethyl-4-oxobut-2-enamide.
| Compound Name | (E)-4-(4-chlorophenyl)-N,N-dimethyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 13067056 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (E)-4-(4-chlorophenyl)-N,N-dimethyl-4-oxobut-2-enamide |
| SMILES | CN(C)C(=O)/C=C/C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClNO2/c1-14(2)12(16)8-7-11(15)9-3-5-10(13)6-4-9/h3-8H,1-2H3/b8-7+ |
| InChIKey | FBAUZMXPJJBDMQ-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|