C10H14ClN — CID 130671218
(1S)-1-(3-chloro-5-methylphenyl)-N-methylethanamine (PubChem CID 130671218) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is (1S)-1-(3-chloro-5-methylphenyl)-N-methylethanamine.
| Compound Name | (1S)-1-(3-chloro-5-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 130671218 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (1S)-1-(3-chloro-5-methylphenyl)-N-methylethanamine |
| SMILES | CN[C@@H](C)c1cc(C)cc(Cl)c1 |
| InChI | InChI=1S/C10H14ClN/c1-7-4-9(8(2)12-3)6-10(11)5-7/h4-6,8,12H,1-3H3/t8-/m0/s1 |
| InChIKey | VEWZNVWBDXUGSR-QMMMGPOBSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |