C9H13N3O2 — CID 130671464
2-(2-hydroxypropylamino)pyridine-4-carboxamide (PubChem CID 130671464) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(2-hydroxypropylamino)pyridine-4-carboxamide.
| Compound Name | 2-(2-hydroxypropylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130671464 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(2-hydroxypropylamino)pyridine-4-carboxamide |
| SMILES | CC(O)CNc1cc(C(N)=O)ccn1 |
| InChI | InChI=1S/C9H13N3O2/c1-6(13)5-12-8-4-7(9(10)14)2-3-11-8/h2-4,6,13H,5H2,1H3,(H2,10,14)(H,11,12) |
| InChIKey | ZCPNJMOZHPALQU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |