C17H22N2O4S2 — CID 1306734
4-(benzylsulfonylamino)-N,N-diethylbenzenesulfonamide (PubChem CID 1306734) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(benzylsulfonylamino)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(benzylsulfonylamino)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1306734 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-(benzylsulfonylamino)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-3-19(4-2)25(22,23)17-12-10-16(11-13-17)18-24(20,21)14-15-8-6-5-7-9-15/h5-13,18H,3-4,14H2,1-2H3 |
| InChIKey | SSTRNBCGQZSLER-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |