C8H8Cl2N2 — CID 130673471
4-[(2R)-azetidin-2-yl]-2,5-dichloropyridine (PubChem CID 130673471) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 4-[(2R)-azetidin-2-yl]-2,5-dichloropyridine.
| Compound Name | 4-[(2R)-azetidin-2-yl]-2,5-dichloropyridine |
|---|---|
| PubChem CID | 130673471 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 4-[(2R)-azetidin-2-yl]-2,5-dichloropyridine |
| SMILES | Clc1cc([C@H]2CCN2)c(Cl)cn1 |
| InChI | InChI=1S/C8H8Cl2N2/c9-6-4-12-8(10)3-5(6)7-1-2-11-7/h3-4,7,11H,1-2H2/t7-/m1/s1 |
| InChIKey | RMRHAFKJUYBWCO-SSDOTTSWSA-N |
| XLogP | 2.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|