C8H7Cl3N2 — CID 130975037
4-[(2S)-azetidin-2-yl]-2,3,5-trichloropyridine (PubChem CID 130975037) has the molecular formula C8H7Cl3N2 and a molecular weight of 237.52 g/mol. Its IUPAC name is 4-[(2S)-azetidin-2-yl]-2,3,5-trichloropyridine.
| Compound Name | 4-[(2S)-azetidin-2-yl]-2,3,5-trichloropyridine |
|---|---|
| PubChem CID | 130975037 |
| Molecular Formula | C8H7Cl3N2 |
| Molecular Weight | 237.52 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 4-[(2S)-azetidin-2-yl]-2,3,5-trichloropyridine |
| SMILES | Clc1cnc(Cl)c(Cl)c1[C@@H]1CCN1 |
| InChI | InChI=1S/C8H7Cl3N2/c9-4-3-13-8(11)7(10)6(4)5-1-2-12-5/h3,5,12H,1-2H2/t5-/m0/s1 |
| InChIKey | SWYQIKPWYDXMNF-YFKPBYRVSA-N |
| XLogP | 3.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|