C8H5Cl3N2O2 — CID 131448512
(4R)-4-(2,3,5-trichloro-4-pyridinyl)-1,3-oxazolidin-2-one (PubChem CID 131448512) has the molecular formula C8H5Cl3N2O2 and a molecular weight of 267.50 g/mol. Its IUPAC name is (4R)-4-(2,3,5-trichloro-4-pyridinyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(2,3,5-trichloro-4-pyridinyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 131448512 |
| Molecular Formula | C8H5Cl3N2O2 |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 265.94 |
| IUPAC Name | (4R)-4-(2,3,5-trichloro-4-pyridinyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2c(Cl)cnc(Cl)c2Cl)CO1 |
| InChI | InChI=1S/C8H5Cl3N2O2/c9-3-1-12-7(11)6(10)5(3)4-2-15-8(14)13-4/h1,4H,2H2,(H,13,14)/t4-/m0/s1 |
| InChIKey | DTKASRVWDJCZOT-BYPYZUCNSA-N |
| XLogP | 2.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|