C11H22N2O — CID 130677976
N-(2,6-dimethylcyclohexyl)-2-(methylamino)acetamide (PubChem CID 130677976) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-2-(methylamino)acetamide.
| Compound Name | N-(2,6-dimethylcyclohexyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 130677976 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NC1C(C)CCCC1C |
| InChI | InChI=1S/C11H22N2O/c1-8-5-4-6-9(2)11(8)13-10(14)7-12-3/h8-9,11-12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | POHPJPISRXJMGC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |