C7H9FN2O — CID 130678031
4-fluoro-N,N-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 130678031) has the molecular formula C7H9FN2O and a molecular weight of 156.16 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-fluoro-N,N-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130678031 |
| Molecular Formula | C7H9FN2O |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4-fluoro-N,N-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc(F)c[nH]1 |
| InChI | InChI=1S/C7H9FN2O/c1-10(2)7(11)6-3-5(8)4-9-6/h3-4,9H,1-2H3 |
| InChIKey | XPNYDNCXYIHRAZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |