C6H7FN2O — CID 130962748
4-fluoro-N-methyl-1H-pyrrole-2-carboxamide (PubChem CID 130962748) has the molecular formula C6H7FN2O and a molecular weight of 142.13 g/mol. Its IUPAC name is 4-fluoro-N-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-fluoro-N-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130962748 |
| Molecular Formula | C6H7FN2O |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 4-fluoro-N-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CNC(=O)c1cc(F)c[nH]1 |
| InChI | InChI=1S/C6H7FN2O/c1-8-6(10)5-2-4(7)3-9-5/h2-3,9H,1H3,(H,8,10) |
| InChIKey | WZVQOUPIZFODJW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |