C17H26FN3O2 — CID 167752880
4-fluoro-N-[1-[(2-methylhexanoylamino)methyl]cyclobutyl]-1H-pyrrole-2-carboxamide (PubChem CID 167752880) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 4-fluoro-N-[1-[(2-methylhexanoylamino)methyl]cyclobutyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-fluoro-N-[1-[(2-methylhexanoylamino)methyl]cyclobutyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 167752880 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-fluoro-N-[1-[(2-methylhexanoylamino)methyl]cyclobutyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCCCC(C)C(=O)NCC1(NC(=O)c2cc(F)c[nH]2)CCC1 |
| InChI | InChI=1S/C17H26FN3O2/c1-3-4-6-12(2)15(22)20-11-17(7-5-8-17)21-16(23)14-9-13(18)10-19-14/h9-10,12,19H,3-8,11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZXUALPVOIHUGFD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |