C9H19NOS — CID 130678514
4-butyl-2-methyl-1,4-thiazinane 1-oxide (PubChem CID 130678514) has the molecular formula C9H19NOS and a molecular weight of 189.32 g/mol. Its IUPAC name is 4-butyl-2-methyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-butyl-2-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 130678514 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 4-butyl-2-methyl-1,4-thiazinane 1-oxide |
| SMILES | CCCCN1CCS(=O)C(C)C1 |
| InChI | InChI=1S/C9H19NOS/c1-3-4-5-10-6-7-12(11)9(2)8-10/h9H,3-8H2,1-2H3 |
| InChIKey | FCCQIQSPHIIYIK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |