C9H16BrNOS — CID 130627712
4-[2-(bromomethyl)prop-2-enyl]-2-methyl-1,4-thiazinane 1-oxide (PubChem CID 130627712) has the molecular formula C9H16BrNOS and a molecular weight of 266.20 g/mol. Its IUPAC name is 4-[2-(bromomethyl)prop-2-enyl]-2-methyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-[2-(bromomethyl)prop-2-enyl]-2-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 130627712 |
| Molecular Formula | C9H16BrNOS |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 4-[2-(bromomethyl)prop-2-enyl]-2-methyl-1,4-thiazinane 1-oxide |
| SMILES | C=C(CBr)CN1CCS(=O)C(C)C1 |
| InChI | InChI=1S/C9H16BrNOS/c1-8(5-10)6-11-3-4-13(12)9(2)7-11/h9H,1,3-7H2,2H3 |
| InChIKey | GKUUPOUCXUBLKK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|