C7H11NO4S — CID 131106295
2-(2-methyl-1-oxo-1,4-thiazinan-4-yl)-2-oxoacetic acid (PubChem CID 131106295) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-(2-methyl-1-oxo-1,4-thiazinan-4-yl)-2-oxoacetic acid.
| Compound Name | 2-(2-methyl-1-oxo-1,4-thiazinan-4-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 131106295 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-(2-methyl-1-oxo-1,4-thiazinan-4-yl)-2-oxoacetic acid |
| SMILES | CC1CN(C(=O)C(=O)O)CCS1=O |
| InChI | InChI=1S/C7H11NO4S/c1-5-4-8(2-3-13(5)12)6(9)7(10)11/h5H,2-4H2,1H3,(H,10,11) |
| InChIKey | QNFPAYWPLISQSO-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|