C9H19NO2S — CID 130666898
3-(2-methyl-1-oxo-1,4-thiazinan-4-yl)butan-2-ol (PubChem CID 130666898) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 3-(2-methyl-1-oxo-1,4-thiazinan-4-yl)butan-2-ol.
| Compound Name | 3-(2-methyl-1-oxo-1,4-thiazinan-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 130666898 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-(2-methyl-1-oxo-1,4-thiazinan-4-yl)butan-2-ol |
| SMILES | CC(O)C(C)N1CCS(=O)C(C)C1 |
| InChI | InChI=1S/C9H19NO2S/c1-7-6-10(4-5-13(7)12)8(2)9(3)11/h7-9,11H,4-6H2,1-3H3 |
| InChIKey | OJDWCJUCXJONKL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |