C11H20N2O2 — CID 130679544
1-(azetidin-3-yl)-2-(1,3-dioxolan-2-yl)piperidine (PubChem CID 130679544) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-2-(1,3-dioxolan-2-yl)piperidine.
| Compound Name | 1-(azetidin-3-yl)-2-(1,3-dioxolan-2-yl)piperidine |
|---|---|
| PubChem CID | 130679544 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-(azetidin-3-yl)-2-(1,3-dioxolan-2-yl)piperidine |
| SMILES | C1CCN(C2CNC2)C(C2OCCO2)C1 |
| InChI | InChI=1S/C11H20N2O2/c1-2-4-13(9-7-12-8-9)10(3-1)11-14-5-6-15-11/h9-12H,1-8H2 |
| InChIKey | DCWJPQDXWXTVKR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |