About (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane
(1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane (PubChem CID 102394338) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane.
Analyze (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane?
The IUPAC name of (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane (CID 102394338) is (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane.
What is the SMILES notation for (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane?
The canonical SMILES for (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane is C1C[C@H]2[C@H]3CCO[C@H]3ON2C1.
What is the InChIKey of (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane?
The InChIKey is MFELUBJTZYFRAP-CSMHCCOUSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-7-6-3-5-10-8(6)11-9(7)4-1/h6-8H,1-5H2/t6-,7+,8+/m1/s1.
What are the key properties of (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane?
(1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane has a molecular weight of 155.20 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R,6S)-5,7-dioxa-8-azatricyclo[6.3.0.02,6]undecane is sourced from PubChem (CID 102394338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).