C9H12ClNS — CID 130679836
1-[2-(2-chlorothiophen-3-yl)cyclopropyl]-N-methylmethanamine (PubChem CID 130679836) has the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. Its IUPAC name is 1-[2-(2-chlorothiophen-3-yl)cyclopropyl]-N-methylmethanamine.
| Compound Name | 1-[2-(2-chlorothiophen-3-yl)cyclopropyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 130679836 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 1-[2-(2-chlorothiophen-3-yl)cyclopropyl]-N-methylmethanamine |
| SMILES | CNCC1CC1c1ccsc1Cl |
| InChI | InChI=1S/C9H12ClNS/c1-11-5-6-4-8(6)7-2-3-12-9(7)10/h2-3,6,8,11H,4-5H2,1H3 |
| InChIKey | OGFXIFXPHQDVIV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |