C16H12F3NOS — CID 13068342
5-[2-(trifluoromethyl)phenyl]-1,5-dihydro-4,1-benzoxazepine-2-thione (PubChem CID 13068342) has the molecular formula C16H12F3NOS and a molecular weight of 323.34 g/mol. Its IUPAC name is 5-[2-(trifluoromethyl)phenyl]-1,5-dihydro-4,1-benzoxazepine-2-thione.
| Compound Name | 5-[2-(trifluoromethyl)phenyl]-1,5-dihydro-4,1-benzoxazepine-2-thione |
|---|---|
| PubChem CID | 13068342 |
| Molecular Formula | C16H12F3NOS |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 5-[2-(trifluoromethyl)phenyl]-1,5-dihydro-4,1-benzoxazepine-2-thione |
| SMILES | FC(F)(F)c1ccccc1C1OCC(=S)Nc2ccccc21 |
| InChI | InChI=1S/C16H12F3NOS/c17-16(18,19)12-7-3-1-5-10(12)15-11-6-2-4-8-13(11)20-14(22)9-21-15/h1-8,15H,9H2,(H,20,22) |
| InChIKey | XEQNAWACONXHSV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|