C15H10ClF3N2OS — CID 143456096
(5S)-7-chloro-5-[2-(trifluoromethyl)-3-pyridinyl]-1,5-dihydro-4,1-benzoxazepine-2-thione (PubChem CID 143456096) has the molecular formula C15H10ClF3N2OS and a molecular weight of 358.77 g/mol. Its IUPAC name is (5S)-7-chloro-5-[2-(trifluoromethyl)-3-pyridinyl]-1,5-dihydro-4,1-benzoxazepine-2-thione.
| Compound Name | (5S)-7-chloro-5-[2-(trifluoromethyl)-3-pyridinyl]-1,5-dihydro-4,1-benzoxazepine-2-thione |
|---|---|
| PubChem CID | 143456096 |
| Molecular Formula | C15H10ClF3N2OS |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (5S)-7-chloro-5-[2-(trifluoromethyl)-3-pyridinyl]-1,5-dihydro-4,1-benzoxazepine-2-thione |
| SMILES | FC(F)(F)c1ncccc1[C@H]1OCC(=S)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H10ClF3N2OS/c16-8-3-4-11-10(6-8)13(22-7-12(23)21-11)9-2-1-5-20-14(9)15(17,18)19/h1-6,13H,7H2,(H,21,23)/t13-/m1/s1 |
| InChIKey | VMRNZNXSTDJDDC-CYBMUJFWSA-N |
| XLogP | 4.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|