C10H20N2S2 — CID 130684129
1-(1,2,5-dithiazepan-5-ylmethyl)cyclopentan-1-amine (PubChem CID 130684129) has the molecular formula C10H20N2S2 and a molecular weight of 232.42 g/mol. Its IUPAC name is 1-(1,2,5-dithiazepan-5-ylmethyl)cyclopentan-1-amine.
| Compound Name | 1-(1,2,5-dithiazepan-5-ylmethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 130684129 |
| Molecular Formula | C10H20N2S2 |
| Molecular Weight | 232.42 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(1,2,5-dithiazepan-5-ylmethyl)cyclopentan-1-amine |
| SMILES | NC1(CN2CCSSCC2)CCCC1 |
| InChI | InChI=1S/C10H20N2S2/c11-10(3-1-2-4-10)9-12-5-7-13-14-8-6-12/h1-9,11H2 |
| InChIKey | BEXPPBKFSDXDNL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|