C8H11NO2 — CID 130684235
aziridin-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 130684235) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is aziridin-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | aziridin-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 130684235 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | aziridin-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | O=C(C1=CCCCO1)N1CC1 |
| InChI | InChI=1S/C8H11NO2/c10-8(9-4-5-9)7-3-1-2-6-11-7/h3H,1-2,4-6H2 |
| InChIKey | UWPVIIVIBVTFSX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|