C12H13NO2 — CID 95934942
N,N-bis(prop-2-ynyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 95934942) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is N,N-bis(prop-2-ynyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N,N-bis(prop-2-ynyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 95934942 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N,N-bis(prop-2-ynyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C#CCN(CC#C)C(=O)C1=CCCCO1 |
| InChI | InChI=1S/C12H13NO2/c1-3-8-13(9-4-2)12(14)11-7-5-6-10-15-11/h1-2,7H,5-6,8-10H2 |
| InChIKey | ZLSRAUWATLLSBL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|