C8H10BrNO2S — CID 130684536
5-bromo-4-methoxy-N,N-dimethylthiophene-2-carboxamide (PubChem CID 130684536) has the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N,N-dimethylthiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methoxy-N,N-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 130684536 |
| Molecular Formula | C8H10BrNO2S |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 5-bromo-4-methoxy-N,N-dimethylthiophene-2-carboxamide |
| SMILES | COc1cc(C(=O)N(C)C)sc1Br |
| InChI | InChI=1S/C8H10BrNO2S/c1-10(2)8(11)6-4-5(12-3)7(9)13-6/h4H,1-3H3 |
| InChIKey | ZAUQLIRTVNNFHA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |