C12H16BrNO4S — CID 120522496
6-[(5-bromo-4-methoxythiophene-2-carbonyl)amino]hexanoic acid (PubChem CID 120522496) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 6-[(5-bromo-4-methoxythiophene-2-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(5-bromo-4-methoxythiophene-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120522496 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 6-[(5-bromo-4-methoxythiophene-2-carbonyl)amino]hexanoic acid |
| SMILES | COc1cc(C(=O)NCCCCCC(=O)O)sc1Br |
| InChI | InChI=1S/C12H16BrNO4S/c1-18-8-7-9(19-11(8)13)12(17)14-6-4-2-3-5-10(15)16/h7H,2-6H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | XHHJWQFXEUULLP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|