C6H6N6S — CID 130686231
4-methyl-2-(2H-tetrazol-5-ylsulfanyl)pyrimidine (PubChem CID 130686231) has the molecular formula C6H6N6S and a molecular weight of 194.22 g/mol. Its IUPAC name is 4-methyl-2-(2H-tetrazol-5-ylsulfanyl)pyrimidine.
| Compound Name | 4-methyl-2-(2H-tetrazol-5-ylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 130686231 |
| Molecular Formula | C6H6N6S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4-methyl-2-(2H-tetrazol-5-ylsulfanyl)pyrimidine |
| SMILES | Cc1ccnc(Sc2nn[nH]n2)n1 |
| InChI | InChI=1S/C6H6N6S/c1-4-2-3-7-5(8-4)13-6-9-11-12-10-6/h2-3H,1H3,(H,9,10,11,12) |
| InChIKey | UDFHZCKAEHMFAY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |