2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid

C8H9NO2S2 — CID 130686453

IUPAC2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(SC2CCC2)n1
InChIInChI=1S/C8H9NO2S2/c10-7(11)6-4-12-8(9-6)13-5-2-1-3-5/h4-5H,1-3H2,(H,10,11)
InChIKeyNVXCSRJOFCDLQN-UHFFFAOYSA-N
MW215.30 g/mol
LogP2.49
Rot. Bonds3

About 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid

2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid (PubChem CID 130686453) has the molecular formula C8H9NO2S2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid
PubChem CID130686453
Molecular FormulaC8H9NO2S2
Molecular Weight215.30 g/mol
Exact Mass215.01
IUPAC Name2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(SC2CCC2)n1
InChIInChI=1S/C8H9NO2S2/c10-7(11)6-4-12-8(9-6)13-5-2-1-3-5/h4-5H,1-3H2,(H,10,11)
InChIKeyNVXCSRJOFCDLQN-UHFFFAOYSA-N
XLogP2.49
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.30
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid (CID 130686453) is 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(SC2CCC2)n1.
What is the InChIKey of 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is NVXCSRJOFCDLQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S2/c10-7(11)6-4-12-8(9-6)13-5-2-1-3-5/h4-5H,1-3H2,(H,10,11).
What are the key properties of 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid?
2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 215.30 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylsulfanyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 130686453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).