C11H19NOS — CID 130688439
2,4-dimethyl-3-(3-methyl-1,2-thiazol-5-yl)pentan-3-ol (PubChem CID 130688439) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 2,4-dimethyl-3-(3-methyl-1,2-thiazol-5-yl)pentan-3-ol.
| Compound Name | 2,4-dimethyl-3-(3-methyl-1,2-thiazol-5-yl)pentan-3-ol |
|---|---|
| PubChem CID | 130688439 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2,4-dimethyl-3-(3-methyl-1,2-thiazol-5-yl)pentan-3-ol |
| SMILES | Cc1cc(C(O)(C(C)C)C(C)C)sn1 |
| InChI | InChI=1S/C11H19NOS/c1-7(2)11(13,8(3)4)10-6-9(5)12-14-10/h6-8,13H,1-5H3 |
| InChIKey | FRHFYCPTQRZCCA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |