C12H21NO — CID 130689650
(2R,3R)-N-(cyclohex-3-en-1-ylmethyl)-2-methyloxolan-3-amine (PubChem CID 130689650) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2R,3R)-N-(cyclohex-3-en-1-ylmethyl)-2-methyloxolan-3-amine.
| Compound Name | (2R,3R)-N-(cyclohex-3-en-1-ylmethyl)-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 130689650 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2R,3R)-N-(cyclohex-3-en-1-ylmethyl)-2-methyloxolan-3-amine |
| SMILES | C[C@H]1OCC[C@H]1NCC1CC=CCC1 |
| InChI | InChI=1S/C12H21NO/c1-10-12(7-8-14-10)13-9-11-5-3-2-4-6-11/h2-3,10-13H,4-9H2,1H3/t10-,11?,12-/m1/s1 |
| InChIKey | VPTDMFVHXRGVNU-IGBJHFKCSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|