C5H11NO3S — CID 130690732
N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfinamide (PubChem CID 130690732) has the molecular formula C5H11NO3S and a molecular weight of 165.21 g/mol. Its IUPAC name is N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfinamide.
| Compound Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfinamide |
|---|---|
| PubChem CID | 130690732 |
| Molecular Formula | C5H11NO3S |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfinamide |
| SMILES | CS(=O)N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C5H11NO3S/c1-10(8)6-4-2-9-3-5(4)7/h4-7H,2-3H2,1H3/t4-,5-,10?/m1/s1 |
| InChIKey | UKDKPKPHNNLYFQ-JVBJKDCASA-N |
| XLogP | -1.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |