C8H13NO2 — CID 130694234
N-ethyl-N-methyl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130694234) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-ethyl-N-methyl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130694234 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | N-ethyl-N-methyl-2,3-dihydrofuran-5-carboxamide |
| SMILES | CCN(C)C(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H13NO2/c1-3-9(2)8(10)7-5-4-6-11-7/h5H,3-4,6H2,1-2H3 |
| InChIKey | MREBUKUALDOBGE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |