C8H11NO5 — CID 130696078
3-[(3-methyloxolan-3-yl)amino]-2,3-dioxopropanoic acid (PubChem CID 130696078) has the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. Its IUPAC name is 3-[(3-methyloxolan-3-yl)amino]-2,3-dioxopropanoic acid.
| Compound Name | 3-[(3-methyloxolan-3-yl)amino]-2,3-dioxopropanoic acid |
|---|---|
| PubChem CID | 130696078 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-[(3-methyloxolan-3-yl)amino]-2,3-dioxopropanoic acid |
| SMILES | CC1(NC(=O)C(=O)C(=O)O)CCOC1 |
| InChI | InChI=1S/C8H11NO5/c1-8(2-3-14-4-8)9-6(11)5(10)7(12)13/h2-4H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | NBIUJHHLNJGRSL-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|