C9H15N3O2 — CID 130701602
5-[(2-methylmorpholin-4-yl)methyl]-1,3-oxazol-2-amine (PubChem CID 130701602) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-[(2-methylmorpholin-4-yl)methyl]-1,3-oxazol-2-amine.
| Compound Name | 5-[(2-methylmorpholin-4-yl)methyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 130701602 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-[(2-methylmorpholin-4-yl)methyl]-1,3-oxazol-2-amine |
| SMILES | CC1CN(Cc2cnc(N)o2)CCO1 |
| InChI | InChI=1S/C9H15N3O2/c1-7-5-12(2-3-13-7)6-8-4-11-9(10)14-8/h4,7H,2-3,5-6H2,1H3,(H2,10,11) |
| InChIKey | KIIUUVMVPJGACX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |