C9H14N2O2 — CID 130668586
2-methyl-4-(1,2-oxazol-5-ylmethyl)morpholine (PubChem CID 130668586) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-methyl-4-(1,2-oxazol-5-ylmethyl)morpholine.
| Compound Name | 2-methyl-4-(1,2-oxazol-5-ylmethyl)morpholine |
|---|---|
| PubChem CID | 130668586 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-methyl-4-(1,2-oxazol-5-ylmethyl)morpholine |
| SMILES | CC1CN(Cc2ccno2)CCO1 |
| InChI | InChI=1S/C9H14N2O2/c1-8-6-11(4-5-12-8)7-9-2-3-10-13-9/h2-3,8H,4-7H2,1H3 |
| InChIKey | GLEMULDTTUHRBY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |