C7H12O3 — CID 13070325
1,1,4-trimethoxybut-2-yne (PubChem CID 13070325) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 1,1,4-trimethoxybut-2-yne.
| Compound Name | 1,1,4-trimethoxybut-2-yne |
|---|---|
| PubChem CID | 13070325 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 1,1,4-trimethoxybut-2-yne |
| SMILES | COCC#CC(OC)OC |
| InChI | InChI=1S/C7H12O3/c1-8-6-4-5-7(9-2)10-3/h7H,6H2,1-3H3 |
| InChIKey | UPPRPJVVCGANAV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|