C21H36O3 — CID 158320371
2,5-dimethylhex-3-yn-2-ol;1-methoxy-4-methylpent-2-yne;4-methylpent-2-yn-1-ol (PubChem CID 158320371) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2,5-dimethylhex-3-yn-2-ol;1-methoxy-4-methylpent-2-yne;4-methylpent-2-yn-1-ol.
| Compound Name | 2,5-dimethylhex-3-yn-2-ol;1-methoxy-4-methylpent-2-yne;4-methylpent-2-yn-1-ol |
|---|---|
| PubChem CID | 158320371 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 2,5-dimethylhex-3-yn-2-ol;1-methoxy-4-methylpent-2-yne;4-methylpent-2-yn-1-ol |
| SMILES | CC(C)C#CC(C)(C)O.CC(C)C#CCO.COCC#CC(C)C |
| InChI | InChI=1S/C8H14O.C7H12O.C6H10O/c1-7(2)5-6-8(3,4)9;1-7(2)5-4-6-8-3;1-6(2)4-3-5-7/h7,9H,1-4H3;7H,6H2,1-3H3;6-7H,5H2,1-2H3 |
| InChIKey | GOTSHNXVBZIJRO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|