C14H24O2 — CID 157228272
2,5-dimethylhex-3-yn-2-ol;4-methylpent-2-yn-1-ol (PubChem CID 157228272) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2,5-dimethylhex-3-yn-2-ol;4-methylpent-2-yn-1-ol.
| Compound Name | 2,5-dimethylhex-3-yn-2-ol;4-methylpent-2-yn-1-ol |
|---|---|
| PubChem CID | 157228272 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2,5-dimethylhex-3-yn-2-ol;4-methylpent-2-yn-1-ol |
| SMILES | CC(C)C#CC(C)(C)O.CC(C)C#CCO |
| InChI | InChI=1S/C8H14O.C6H10O/c1-7(2)5-6-8(3,4)9;1-6(2)4-3-5-7/h7,9H,1-4H3;6-7H,5H2,1-2H3 |
| InChIKey | ATUOBMJRQQNRLR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|