About 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine
4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine (PubChem CID 130707374) has the molecular formula C9H7F3N2
and a molecular weight of 200.16 g/mol. Its IUPAC name is 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine.
Analyze 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine?
The IUPAC name of 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine (CID 130707374) is 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine.
What is the SMILES notation for 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine?
The canonical SMILES for 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine is Cc1cccn2nc(C(F)(F)F)cc12.
What is the InChIKey of 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine?
The InChIKey is XTJFZEUYZPVLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2/c1-6-3-2-4-14-7(6)5-8(13-14)9(10,11)12/h2-5H,1H3.
What are the key properties of 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine?
4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine has a molecular weight of 200.16 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine is sourced from PubChem (CID 130707374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).