C12H12F3N3 — CID 82088628
1-(2,6-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine (PubChem CID 82088628) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 82088628 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine |
| SMILES | Cc1cccc(C)c1-n1nc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H12F3N3/c1-7-4-3-5-8(2)11(7)18-10(16)6-9(17-18)12(13,14)15/h3-6H,16H2,1-2H3 |
| InChIKey | YSOCCAXGSOAULI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |