C10H6FNOS — CID 130709729
(4-fluorophenyl)-(1,2-thiazol-3-yl)methanone (PubChem CID 130709729) has the molecular formula C10H6FNOS and a molecular weight of 207.23 g/mol. Its IUPAC name is (4-fluorophenyl)-(1,2-thiazol-3-yl)methanone.
| Compound Name | (4-fluorophenyl)-(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 130709729 |
| Molecular Formula | C10H6FNOS |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | (4-fluorophenyl)-(1,2-thiazol-3-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1ccsn1 |
| InChI | InChI=1S/C10H6FNOS/c11-8-3-1-7(2-4-8)10(13)9-5-6-14-12-9/h1-6H |
| InChIKey | XZZUVLWIIPVCDC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |