About bromoseleninylbenzene
bromoseleninylbenzene (PubChem CID 13071060) has the molecular formula C6H5BrOSe
and a molecular weight of 251.97 g/mol. Its IUPAC name is bromoseleninylbenzene.
Molecular Properties
| Compound Name | bromoseleninylbenzene |
| PubChem CID | 13071060 |
| Molecular Formula | C6H5BrOSe |
| Molecular Weight | 251.97 g/mol |
| Exact Mass | 251.87 |
| IUPAC Name | bromoseleninylbenzene |
| SMILES | O=[Se](Br)c1ccccc1 |
| InChI | InChI=1S/C6H5BrOSe/c7-9(8)6-4-2-1-3-5-6/h1-5H |
| InChIKey | MILKUWSCMTXIBS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.97 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromoseleninylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromoseleninylbenzene?
The IUPAC name of bromoseleninylbenzene (CID 13071060) is bromoseleninylbenzene.
What is the SMILES notation for bromoseleninylbenzene?
The canonical SMILES for bromoseleninylbenzene is O=[Se](Br)c1ccccc1.
What is the InChIKey of bromoseleninylbenzene?
The InChIKey is MILKUWSCMTXIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrOSe/c7-9(8)6-4-2-1-3-5-6/h1-5H.
What are the key properties of bromoseleninylbenzene?
bromoseleninylbenzene has a molecular weight of 251.97 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromoseleninylbenzene is sourced from PubChem (CID 13071060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).