About phenylseleninyl benzeneselenonate
phenylseleninyl benzeneselenonate (PubChem CID 141046145) has the molecular formula C12H10O4Se2
and a molecular weight of 376.13 g/mol. Its IUPAC name is phenylseleninyl benzeneselenonate.
Molecular Properties
| Compound Name | phenylseleninyl benzeneselenonate |
| PubChem CID | 141046145 |
| Molecular Formula | C12H10O4Se2 |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 377.89 |
| IUPAC Name | phenylseleninyl benzeneselenonate |
| SMILES | O=[Se](O[Se](=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O4Se2/c13-17(11-7-3-1-4-8-11)16-18(14,15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | LGLZYNREBDZRLM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylseleninyl benzeneselenonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylseleninyl benzeneselenonate?
The IUPAC name of phenylseleninyl benzeneselenonate (CID 141046145) is phenylseleninyl benzeneselenonate.
What is the SMILES notation for phenylseleninyl benzeneselenonate?
The canonical SMILES for phenylseleninyl benzeneselenonate is O=[Se](O[Se](=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of phenylseleninyl benzeneselenonate?
The InChIKey is LGLZYNREBDZRLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4Se2/c13-17(11-7-3-1-4-8-11)16-18(14,15)12-9-5-2-6-10-12/h1-10H.
What are the key properties of phenylseleninyl benzeneselenonate?
phenylseleninyl benzeneselenonate has a molecular weight of 376.13 g/mol, XLogP of 0.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylseleninyl benzeneselenonate is sourced from PubChem (CID 141046145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).