C8H14N2O3 — CID 130711052
3-methyl-N-[2-(methylamino)-2-oxoethyl]oxetane-3-carboxamide (PubChem CID 130711052) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-methyl-N-[2-(methylamino)-2-oxoethyl]oxetane-3-carboxamide.
| Compound Name | 3-methyl-N-[2-(methylamino)-2-oxoethyl]oxetane-3-carboxamide |
|---|---|
| PubChem CID | 130711052 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3-methyl-N-[2-(methylamino)-2-oxoethyl]oxetane-3-carboxamide |
| SMILES | CNC(=O)CNC(=O)C1(C)COC1 |
| InChI | InChI=1S/C8H14N2O3/c1-8(4-13-5-8)7(12)10-3-6(11)9-2/h3-5H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | KCBMPOXZPQLASD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |