C9H15NO2 — CID 130711085
N-butan-2-yl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130711085) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is N-butan-2-yl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-butan-2-yl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130711085 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | N-butan-2-yl-2,3-dihydrofuran-5-carboxamide |
| SMILES | CCC(C)NC(=O)C1=CCCO1 |
| InChI | InChI=1S/C9H15NO2/c1-3-7(2)10-9(11)8-5-4-6-12-8/h5,7H,3-4,6H2,1-2H3,(H,10,11) |
| InChIKey | JFXRCFGJNUUDQQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |