C8H13FN2O2 — CID 130715487
3-(3-fluorobutyl)-1-methylimidazolidine-2,4-dione (PubChem CID 130715487) has the molecular formula C8H13FN2O2 and a molecular weight of 188.20 g/mol. Its IUPAC name is 3-(3-fluorobutyl)-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-(3-fluorobutyl)-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130715487 |
| Molecular Formula | C8H13FN2O2 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3-(3-fluorobutyl)-1-methylimidazolidine-2,4-dione |
| SMILES | CC(F)CCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C8H13FN2O2/c1-6(9)3-4-11-7(12)5-10(2)8(11)13/h6H,3-5H2,1-2H3 |
| InChIKey | CFHFRUZEAZDZFO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|