C9H13NOS — CID 130718298
2-cyclopropyl-1-(1,2-thiazol-3-yl)propan-1-ol (PubChem CID 130718298) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-cyclopropyl-1-(1,2-thiazol-3-yl)propan-1-ol.
| Compound Name | 2-cyclopropyl-1-(1,2-thiazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 130718298 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2-cyclopropyl-1-(1,2-thiazol-3-yl)propan-1-ol |
| SMILES | CC(C1CC1)C(O)c1ccsn1 |
| InChI | InChI=1S/C9H13NOS/c1-6(7-2-3-7)9(11)8-4-5-12-10-8/h4-7,9,11H,2-3H2,1H3 |
| InChIKey | KTQUTWKHILBTDH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |