C7H9NOS — CID 127002567
cyclopropyl(1,2-thiazol-3-yl)methanol (PubChem CID 127002567) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is cyclopropyl(1,2-thiazol-3-yl)methanol.
| Compound Name | cyclopropyl(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 127002567 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | cyclopropyl(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)C1CC1 |
| InChI | InChI=1S/C7H9NOS/c9-7(5-1-2-5)6-3-4-10-8-6/h3-5,7,9H,1-2H2 |
| InChIKey | JXTJVRPFCAACRD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |